C17H23N3O3 — CID 110433392
4-(azepan-1-yl)-6,7,8-trimethoxyquinazoline (PubChem CID 110433392) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-(azepan-1-yl)-6,7,8-trimethoxyquinazoline.
| Compound Name | 4-(azepan-1-yl)-6,7,8-trimethoxyquinazoline |
|---|---|
| PubChem CID | 110433392 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-(azepan-1-yl)-6,7,8-trimethoxyquinazoline |
| SMILES | COc1cc2c(N3CCCCCC3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C17H23N3O3/c1-21-13-10-12-14(16(23-3)15(13)22-2)18-11-19-17(12)20-8-6-4-5-7-9-20/h10-11H,4-9H2,1-3H3 |
| InChIKey | PJLBFEGMVHKILI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |