C15H21N3O5 — CID 110433388
2-[2-hydroxyethyl-(6,7,8-trimethoxyquinazolin-4-yl)amino]ethanol (PubChem CID 110433388) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-(6,7,8-trimethoxyquinazolin-4-yl)amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-(6,7,8-trimethoxyquinazolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 110433388 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[2-hydroxyethyl-(6,7,8-trimethoxyquinazolin-4-yl)amino]ethanol |
| SMILES | COc1cc2c(N(CCO)CCO)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C15H21N3O5/c1-21-11-8-10-12(14(23-3)13(11)22-2)16-9-17-15(10)18(4-6-19)5-7-20/h8-9,19-20H,4-7H2,1-3H3 |
| InChIKey | PAYNBWBPYPHVCX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |