C19H26N4O3 — CID 163275284
tert-butyl N-[2-[1-(8-methoxyquinazolin-4-yl)azetidin-3-yl]ethyl]carbamate (PubChem CID 163275284) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(8-methoxyquinazolin-4-yl)azetidin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(8-methoxyquinazolin-4-yl)azetidin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 163275284 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | tert-butyl N-[2-[1-(8-methoxyquinazolin-4-yl)azetidin-3-yl]ethyl]carbamate |
| SMILES | COc1cccc2c(N3CC(CCNC(=O)OC(C)(C)C)C3)ncnc12 |
| InChI | InChI=1S/C19H26N4O3/c1-19(2,3)26-18(24)20-9-8-13-10-23(11-13)17-14-6-5-7-15(25-4)16(14)21-12-22-17/h5-7,12-13H,8-11H2,1-4H3,(H,20,24) |
| InChIKey | HMJBMALHJMSXLK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |