C22H31N3O3S — CID 176667889
tert-butyl N-[2-[1-(1-methoxyisoquinolin-5-yl)sulfanylpiperidin-4-yl]ethyl]carbamate (PubChem CID 176667889) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(1-methoxyisoquinolin-5-yl)sulfanylpiperidin-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(1-methoxyisoquinolin-5-yl)sulfanylpiperidin-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 176667889 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | tert-butyl N-[2-[1-(1-methoxyisoquinolin-5-yl)sulfanylpiperidin-4-yl]ethyl]carbamate |
| SMILES | COc1nccc2c(SN3CCC(CCNC(=O)OC(C)(C)C)CC3)cccc12 |
| InChI | InChI=1S/C22H31N3O3S/c1-22(2,3)28-21(26)24-12-8-16-10-14-25(15-11-16)29-19-7-5-6-18-17(19)9-13-23-20(18)27-4/h5-7,9,13,16H,8,10-12,14-15H2,1-4H3,(H,24,26) |
| InChIKey | XTMUBJGTYIUXKI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|