C23H34N3O6P — CID 175387349
ethyl 3-[2-diethoxyphosphoryl-1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]propanoate (PubChem CID 175387349) has the molecular formula C23H34N3O6P and a molecular weight of 479.51 g/mol. Its IUPAC name is ethyl 3-[2-diethoxyphosphoryl-1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]propanoate.
| Compound Name | ethyl 3-[2-diethoxyphosphoryl-1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 175387349 |
| Molecular Formula | C23H34N3O6P |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | ethyl 3-[2-diethoxyphosphoryl-1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]propanoate |
| SMILES | CCOC(=O)CCC1CCN(c2ncnc3c(OC)cccc23)C(P(=O)(OCC)OCC)C1 |
| InChI | InChI=1S/C23H34N3O6P/c1-5-30-21(27)12-11-17-13-14-26(20(15-17)33(28,31-6-2)32-7-3)23-18-9-8-10-19(29-4)22(18)24-16-25-23/h8-10,16-17,20H,5-7,11-15H2,1-4H3 |
| InChIKey | PSGALENZCJWKAJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|