C18H22N2O3 — CID 142785566
ethyl 2-(cyclopentylamino)-8-methoxyquinoline-3-carboxylate (PubChem CID 142785566) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl 2-(cyclopentylamino)-8-methoxyquinoline-3-carboxylate.
| Compound Name | ethyl 2-(cyclopentylamino)-8-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 142785566 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethyl 2-(cyclopentylamino)-8-methoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cccc(OC)c2nc1NC1CCCC1 |
| InChI | InChI=1S/C18H22N2O3/c1-3-23-18(21)14-11-12-7-6-10-15(22-2)16(12)20-17(14)19-13-8-4-5-9-13/h6-7,10-11,13H,3-5,8-9H2,1-2H3,(H,19,20) |
| InChIKey | XILGIIYENHCQRO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |