C16H20N2O3S — CID 175183982
methyl (1-quinolin-4-ylpiperidin-4-yl)methanesulfonate (PubChem CID 175183982) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is methyl (1-quinolin-4-ylpiperidin-4-yl)methanesulfonate.
| Compound Name | methyl (1-quinolin-4-ylpiperidin-4-yl)methanesulfonate |
|---|---|
| PubChem CID | 175183982 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | methyl (1-quinolin-4-ylpiperidin-4-yl)methanesulfonate |
| SMILES | COS(=O)(=O)CC1CCN(c2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C16H20N2O3S/c1-21-22(19,20)12-13-7-10-18(11-8-13)16-6-9-17-15-5-3-2-4-14(15)16/h2-6,9,13H,7-8,10-12H2,1H3 |
| InChIKey | WMWDLEPVKULULQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|