C16H20N2O3S — CID 175185586
2-(1-quinolin-4-ylpiperidin-4-yl)ethanesulfonic acid (PubChem CID 175185586) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-(1-quinolin-4-ylpiperidin-4-yl)ethanesulfonic acid.
| Compound Name | 2-(1-quinolin-4-ylpiperidin-4-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 175185586 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(1-quinolin-4-ylpiperidin-4-yl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCC1CCN(c2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C16H20N2O3S/c19-22(20,21)12-8-13-6-10-18(11-7-13)16-5-9-17-15-4-2-1-3-14(15)16/h1-5,9,13H,6-8,10-12H2,(H,19,20,21) |
| InChIKey | CDRSAADJVKTWRD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|