C29H37N3O2S — CID 52919397
5-[[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole (PubChem CID 52919397) has the molecular formula C29H37N3O2S and a molecular weight of 491.70 g/mol. Its IUPAC name is 5-[[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole.
| Compound Name | 5-[[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 52919397 |
| Molecular Formula | C29H37N3O2S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 5-[[(2S)-2-benzyl-4-(3-cyclopentyloxy-4-methoxyphenyl)piperazin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole |
| SMILES | COc1ccc(N2CCN(Cc3sc(C)nc3C)[C@@H](Cc3ccccc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C29H37N3O2S/c1-21-29(35-22(2)30-21)20-32-16-15-31(19-25(32)17-23-9-5-4-6-10-23)24-13-14-27(33-3)28(18-24)34-26-11-7-8-12-26/h4-6,9-10,13-14,18,25-26H,7-8,11-12,15-17,19-20H2,1-3H3/t25-/m0/s1 |
| InChIKey | CMZQPRZKFFZEMR-VWLOTQADSA-N |
| XLogP | 6.02 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|