C27H34N2O5 — CID 58189052
1-[(2S)-2-benzyl-4-(4-methoxy-3-propan-2-yloxyphenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid (PubChem CID 58189052) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-[(2S)-2-benzyl-4-(4-methoxy-3-propan-2-yloxyphenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(2S)-2-benzyl-4-(4-methoxy-3-propan-2-yloxyphenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 58189052 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[(2S)-2-benzyl-4-(4-methoxy-3-propan-2-yloxyphenyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
| SMILES | COc1ccc(N2CCN(C(=O)C3(C(=O)O)CCC3)[C@@H](Cc3ccccc3)C2)cc1OC(C)C |
| InChI | InChI=1S/C27H34N2O5/c1-19(2)34-24-17-21(10-11-23(24)33-3)28-14-15-29(25(30)27(26(31)32)12-7-13-27)22(18-28)16-20-8-5-4-6-9-20/h4-6,8-11,17,19,22H,7,12-16,18H2,1-3H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | WDEMACXQEPLEEM-QFIPXVFZSA-N |
| XLogP | 4.00 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|