C23H35N3O4 — CID 67291254
1-[(2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(morpholin-4-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 67291254) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[(2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(morpholin-4-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(morpholin-4-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 67291254 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 1-[(2S)-4-(3-cyclopentyloxy-4-methoxyphenyl)-2-(morpholin-4-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(C)=O)[C@@H](CN3CCOCC3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H35N3O4/c1-18(27)26-10-9-25(17-20(26)16-24-11-13-29-14-12-24)19-7-8-22(28-2)23(15-19)30-21-5-3-4-6-21/h7-8,15,20-21H,3-6,9-14,16-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | HBIDUEAIPQUMRG-FQEVSTJZSA-N |
| XLogP | 2.39 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|