C23H32N4O3 — CID 67291509
1-[(2R)-4-(3-cyclopentyloxy-4-ethoxyphenyl)-2-(pyrazol-1-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 67291509) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[(2R)-4-(3-cyclopentyloxy-4-ethoxyphenyl)-2-(pyrazol-1-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[(2R)-4-(3-cyclopentyloxy-4-ethoxyphenyl)-2-(pyrazol-1-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 67291509 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-[(2R)-4-(3-cyclopentyloxy-4-ethoxyphenyl)-2-(pyrazol-1-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | CCOc1ccc(N2CCN(C(C)=O)[C@@H](Cn3cccn3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H32N4O3/c1-3-29-22-10-9-19(15-23(22)30-21-7-4-5-8-21)25-13-14-27(18(2)28)20(16-25)17-26-12-6-11-24-26/h6,9-12,15,20-21H,3-5,7-8,13-14,16-17H2,1-2H3/t20-/m1/s1 |
| InChIKey | APKXNGDZFPTZDG-HXUWFJFHSA-N |
| XLogP | 3.34 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|