C33H46N6O11 — CID 158163058
tert-butyl 2-(hydroxymethyl)-4-(4-nitrophenyl)piperazine-1-carboxylate;1-O-tert-butyl 2-O-methyl 4-(4-nitrophenyl)piperazine-1,2-dicarboxylate (PubChem CID 158163058) has the molecular formula C33H46N6O11 and a molecular weight of 702.76 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-4-(4-nitrophenyl)piperazine-1-carboxylate;1-O-tert-butyl 2-O-methyl 4-(4-nitrophenyl)piperazine-1,2-dicarboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-4-(4-nitrophenyl)piperazine-1-carboxylate;1-O-tert-butyl 2-O-methyl 4-(4-nitrophenyl)piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 158163058 |
| Molecular Formula | C33H46N6O11 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-4-(4-nitrophenyl)piperazine-1-carboxylate;1-O-tert-butyl 2-O-methyl 4-(4-nitrophenyl)piperazine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1CO.COC(=O)C1CN(c2ccc([N+](=O)[O-])cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23N3O6.C16H23N3O5/c1-17(2,3)26-16(22)19-10-9-18(11-14(19)15(21)25-4)12-5-7-13(8-6-12)20(23)24;1-16(2,3)24-15(21)18-9-8-17(10-14(18)11-20)12-4-6-13(7-5-12)19(22)23/h5-8,14H,9-11H2,1-4H3;4-7,14,20H,8-11H2,1-3H3 |
| InChIKey | FWNAAAXPCKVDPQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 198.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|