C17H25N3O6 — CID 174811863
tert-butyl (2R)-4-[2-(hydroxymethyl)-4-nitrophenyl]-2-methoxypiperazine-1-carboxylate (PubChem CID 174811863) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is tert-butyl (2R)-4-[2-(hydroxymethyl)-4-nitrophenyl]-2-methoxypiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[2-(hydroxymethyl)-4-nitrophenyl]-2-methoxypiperazine-1-carboxylate |
|---|---|
| PubChem CID | 174811863 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | tert-butyl (2R)-4-[2-(hydroxymethyl)-4-nitrophenyl]-2-methoxypiperazine-1-carboxylate |
| SMILES | CO[C@@H]1CN(c2ccc([N+](=O)[O-])cc2CO)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N3O6/c1-17(2,3)26-16(22)19-8-7-18(10-15(19)25-4)14-6-5-13(20(23)24)9-12(14)11-21/h5-6,9,15,21H,7-8,10-11H2,1-4H3/t15-/m1/s1 |
| InChIKey | JASXPKWHXCLEPC-OAHLLOKOSA-N |
| XLogP | 2.12 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|