C20H30N2O3 — CID 69099189
tert-butyl (2R)-4-(4-cyclopropyl-3-methoxyphenyl)-2-methylpiperazine-1-carboxylate (PubChem CID 69099189) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl (2R)-4-(4-cyclopropyl-3-methoxyphenyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(4-cyclopropyl-3-methoxyphenyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69099189 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl (2R)-4-(4-cyclopropyl-3-methoxyphenyl)-2-methylpiperazine-1-carboxylate |
| SMILES | COc1cc(N2CCN(C(=O)OC(C)(C)C)[C@H](C)C2)ccc1C1CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-14-13-21(10-11-22(14)19(23)25-20(2,3)4)16-8-9-17(15-6-7-15)18(12-16)24-5/h8-9,12,14-15H,6-7,10-11,13H2,1-5H3/t14-/m1/s1 |
| InChIKey | IIJBXEGUSGYOEL-CQSZACIVSA-N |
| XLogP | 4.02 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |