C22H33BrClN3O3 — CID 175486205
tert-butyl 4-(4-bromophenyl)-2-[[(2-chloro-4-methylpentanoyl)amino]methyl]piperazine-1-carboxylate (PubChem CID 175486205) has the molecular formula C22H33BrClN3O3 and a molecular weight of 502.88 g/mol. Its IUPAC name is tert-butyl 4-(4-bromophenyl)-2-[[(2-chloro-4-methylpentanoyl)amino]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-bromophenyl)-2-[[(2-chloro-4-methylpentanoyl)amino]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175486205 |
| Molecular Formula | C22H33BrClN3O3 |
| Molecular Weight | 502.88 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | tert-butyl 4-(4-bromophenyl)-2-[[(2-chloro-4-methylpentanoyl)amino]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)CC(Cl)C(=O)NCC1CN(c2ccc(Br)cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33BrClN3O3/c1-15(2)12-19(24)20(28)25-13-18-14-26(17-8-6-16(23)7-9-17)10-11-27(18)21(29)30-22(3,4)5/h6-9,15,18-19H,10-14H2,1-5H3,(H,25,28) |
| InChIKey | OQIKNZBNLSEMKD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|