C16H23F2N3O2 — CID 145440850
tert-butyl 4-(4-aminophenyl)-2-(difluoromethyl)piperazine-1-carboxylate (PubChem CID 145440850) has the molecular formula C16H23F2N3O2 and a molecular weight of 327.38 g/mol. Its IUPAC name is tert-butyl 4-(4-aminophenyl)-2-(difluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-aminophenyl)-2-(difluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145440850 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | tert-butyl 4-(4-aminophenyl)-2-(difluoromethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N)cc2)CC1C(F)F |
| InChI | InChI=1S/C16H23F2N3O2/c1-16(2,3)23-15(22)21-9-8-20(10-13(21)14(17)18)12-6-4-11(19)5-7-12/h4-7,13-14H,8-10,19H2,1-3H3 |
| InChIKey | ZUGXHDXIBYJKLU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|