C14H21F2N5O2 — CID 167335065
tert-butyl 4-(4-aminopyrimidin-2-yl)-2-(difluoromethyl)piperazine-1-carboxylate (PubChem CID 167335065) has the molecular formula C14H21F2N5O2 and a molecular weight of 329.35 g/mol. Its IUPAC name is tert-butyl 4-(4-aminopyrimidin-2-yl)-2-(difluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-aminopyrimidin-2-yl)-2-(difluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167335065 |
| Molecular Formula | C14H21F2N5O2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | tert-butyl 4-(4-aminopyrimidin-2-yl)-2-(difluoromethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nccc(N)n2)CC1C(F)F |
| InChI | InChI=1S/C14H21F2N5O2/c1-14(2,3)23-13(22)21-7-6-20(8-9(21)11(15)16)12-18-5-4-10(17)19-12/h4-5,9,11H,6-8H2,1-3H3,(H2,17,18,19) |
| InChIKey | ZJOUSOVRLYGRBD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |