C9H13FN4O — CID 165390561
(3R,4S)-1-(4-aminopyrimidin-2-yl)-4-fluoropiperidin-3-ol (PubChem CID 165390561) has the molecular formula C9H13FN4O and a molecular weight of 212.23 g/mol. Its IUPAC name is (3R,4S)-1-(4-aminopyrimidin-2-yl)-4-fluoropiperidin-3-ol.
| Compound Name | (3R,4S)-1-(4-aminopyrimidin-2-yl)-4-fluoropiperidin-3-ol |
|---|---|
| PubChem CID | 165390561 |
| Molecular Formula | C9H13FN4O |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (3R,4S)-1-(4-aminopyrimidin-2-yl)-4-fluoropiperidin-3-ol |
| SMILES | Nc1ccnc(N2CC[C@H](F)[C@H](O)C2)n1 |
| InChI | InChI=1S/C9H13FN4O/c10-6-2-4-14(5-7(6)15)9-12-3-1-8(11)13-9/h1,3,6-7,15H,2,4-5H2,(H2,11,12,13)/t6-,7+/m0/s1 |
| InChIKey | OKWPNCJEAVAJPH-NKWVEPMBSA-N |
| XLogP | -0.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |