C10H12B3FN4O — CID 166546943
CID 166546943 (PubChem CID 166546943) has the molecular formula C10H12B3FN4O and a molecular weight of 255.67 g/mol.
| Compound Name | CID 166546943 |
|---|---|
| PubChem CID | 166546943 |
| Molecular Formula | C10H12B3FN4O |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])OC1CCN(c2nccc(N)n2)CC1F |
| InChI | InChI=1S/C10H12B3FN4O/c11-10(12,13)19-7-2-4-18(5-6(7)14)9-16-3-1-8(15)17-9/h1,3,6-7H,2,4-5H2,(H2,15,16,17) |
| InChIKey | ASMHWZIBQVEJED-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|