C12H20N4O3 — CID 156538204
1-(4-aminopyrimidin-2-yl)-4-(2-methoxyethoxy)piperidin-3-ol (PubChem CID 156538204) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(4-aminopyrimidin-2-yl)-4-(2-methoxyethoxy)piperidin-3-ol.
| Compound Name | 1-(4-aminopyrimidin-2-yl)-4-(2-methoxyethoxy)piperidin-3-ol |
|---|---|
| PubChem CID | 156538204 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-(4-aminopyrimidin-2-yl)-4-(2-methoxyethoxy)piperidin-3-ol |
| SMILES | COCCOC1CCN(c2nccc(N)n2)CC1O |
| InChI | InChI=1S/C12H20N4O3/c1-18-6-7-19-10-3-5-16(8-9(10)17)12-14-4-2-11(13)15-12/h2,4,9-10,17H,3,5-8H2,1H3,(H2,13,14,15) |
| InChIKey | VLSHMXICBZKTNM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|