C10H14N4O2 — CID 116797068
methyl 1-(4-aminopyrimidin-2-yl)pyrrolidine-3-carboxylate (PubChem CID 116797068) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is methyl 1-(4-aminopyrimidin-2-yl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-aminopyrimidin-2-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 116797068 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | methyl 1-(4-aminopyrimidin-2-yl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(c2nccc(N)n2)C1 |
| InChI | InChI=1S/C10H14N4O2/c1-16-9(15)7-3-5-14(6-7)10-12-4-2-8(11)13-10/h2,4,7H,3,5-6H2,1H3,(H2,11,12,13) |
| InChIKey | QYYAZWSDJYUNDI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |