C13H21N3O3S — CID 156550491
(3R,4S)-4-(2-methoxyethoxy)-1-(4-methylsulfanylpyrimidin-2-yl)piperidin-3-ol (PubChem CID 156550491) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (3R,4S)-4-(2-methoxyethoxy)-1-(4-methylsulfanylpyrimidin-2-yl)piperidin-3-ol.
| Compound Name | (3R,4S)-4-(2-methoxyethoxy)-1-(4-methylsulfanylpyrimidin-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 156550491 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3R,4S)-4-(2-methoxyethoxy)-1-(4-methylsulfanylpyrimidin-2-yl)piperidin-3-ol |
| SMILES | COCCO[C@H]1CCN(c2nccc(SC)n2)C[C@H]1O |
| InChI | InChI=1S/C13H21N3O3S/c1-18-7-8-19-11-4-6-16(9-10(11)17)13-14-5-3-12(15-13)20-2/h3,5,10-11,17H,4,6-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | PENZFSABFFANPM-MNOVXSKESA-N |
| XLogP | 0.80 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|