C21H33N3O2 — CID 174086038
tert-butyl (2R)-4-[(6S)-6-amino-5,6,7,8-tetrahydronaphthalen-2-yl]-2-ethylpiperazine-1-carboxylate (PubChem CID 174086038) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is tert-butyl (2R)-4-[(6S)-6-amino-5,6,7,8-tetrahydronaphthalen-2-yl]-2-ethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[(6S)-6-amino-5,6,7,8-tetrahydronaphthalen-2-yl]-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 174086038 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | tert-butyl (2R)-4-[(6S)-6-amino-5,6,7,8-tetrahydronaphthalen-2-yl]-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@@H]1CN(c2ccc3c(c2)CC[C@H](N)C3)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33N3O2/c1-5-18-14-23(10-11-24(18)20(25)26-21(2,3)4)19-9-7-15-12-17(22)8-6-16(15)13-19/h7,9,13,17-18H,5-6,8,10-12,14,22H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | DPUMNHZXCRDOEQ-ZWKOTPCHSA-N |
| XLogP | 3.34 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|