C22H28ClN5O5 — CID 178116179
tert-butyl (2S)-4-[4-[(2-amino-5-chloro-3-nitro-4-pyridinyl)oxy]phenyl]-2-ethylpiperazine-1-carboxylate (PubChem CID 178116179) has the molecular formula C22H28ClN5O5 and a molecular weight of 477.95 g/mol. Its IUPAC name is tert-butyl (2S)-4-[4-[(2-amino-5-chloro-3-nitro-4-pyridinyl)oxy]phenyl]-2-ethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[4-[(2-amino-5-chloro-3-nitro-4-pyridinyl)oxy]phenyl]-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 178116179 |
| Molecular Formula | C22H28ClN5O5 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | tert-butyl (2S)-4-[4-[(2-amino-5-chloro-3-nitro-4-pyridinyl)oxy]phenyl]-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@H]1CN(c2ccc(Oc3c(Cl)cnc(N)c3[N+](=O)[O-])cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28ClN5O5/c1-5-14-13-26(10-11-27(14)21(29)33-22(2,3)4)15-6-8-16(9-7-15)32-19-17(23)12-25-20(24)18(19)28(30)31/h6-9,12,14H,5,10-11,13H2,1-4H3,(H2,24,25)/t14-/m0/s1 |
| InChIKey | CUCCVTLEXJHHCG-AWEZNQCLSA-N |
| XLogP | 4.85 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|