C22H29N3O9 — CID 135143965
2-[4-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide (PubChem CID 135143965) has the molecular formula C22H29N3O9 and a molecular weight of 479.49 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide.
| Compound Name | 2-[4-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 135143965 |
| Molecular Formula | C22H29N3O9 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-[4-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
| SMILES | COCC(=O)NCCOCCOCCOc1cccc2c1C(=O)N(C(CCC=O)C(N)=O)C2=O |
| InChI | InChI=1S/C22H29N3O9/c1-31-14-18(27)24-7-9-32-10-11-33-12-13-34-17-6-2-4-15-19(17)22(30)25(21(15)29)16(20(23)28)5-3-8-26/h2,4,6,8,16H,3,5,7,9-14H2,1H3,(H2,23,28)(H,24,27) |
| InChIKey | JTJTXVXIMGLUSF-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|