C27H38ClN3O7 — CID 170061434
N-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-6-[2-(6-chlorohexoxy)ethoxy]hexanamide (PubChem CID 170061434) has the molecular formula C27H38ClN3O7 and a molecular weight of 552.07 g/mol. Its IUPAC name is N-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-6-[2-(6-chlorohexoxy)ethoxy]hexanamide.
| Compound Name | N-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-6-[2-(6-chlorohexoxy)ethoxy]hexanamide |
|---|---|
| PubChem CID | 170061434 |
| Molecular Formula | C27H38ClN3O7 |
| Molecular Weight | 552.07 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]-6-[2-(6-chlorohexoxy)ethoxy]hexanamide |
| SMILES | NC(=O)C(CCC=O)N1C(=O)c2cccc(NC(=O)CCCCCOCCOCCCCCCCl)c2C1=O |
| InChI | InChI=1S/C27H38ClN3O7/c28-14-5-1-2-6-16-37-18-19-38-17-7-3-4-13-23(33)30-21-11-8-10-20-24(21)27(36)31(26(20)35)22(25(29)34)12-9-15-32/h8,10-11,15,22H,1-7,9,12-14,16-19H2,(H2,29,34)(H,30,33) |
| InChIKey | DNBFVTWAZODXAZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.07 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|