C19H23N3O7 — CID 156542314
2-[4-[4-[(2-hydroxyacetyl)amino]butoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide (PubChem CID 156542314) has the molecular formula C19H23N3O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[4-[4-[(2-hydroxyacetyl)amino]butoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide.
| Compound Name | 2-[4-[4-[(2-hydroxyacetyl)amino]butoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 156542314 |
| Molecular Formula | C19H23N3O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[4-[4-[(2-hydroxyacetyl)amino]butoxy]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
| SMILES | NC(=O)C(CCC=O)N1C(=O)c2cccc(OCCCCNC(=O)CO)c2C1=O |
| InChI | InChI=1S/C19H23N3O7/c20-17(26)13(6-4-9-23)22-18(27)12-5-3-7-14(16(12)19(22)28)29-10-2-1-8-21-15(25)11-24/h3,5,7,9,13,24H,1-2,4,6,8,10-11H2,(H2,20,26)(H,21,25) |
| InChIKey | CLMIHOCSYGTMBO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|