C23H29N5O8 — CID 167048864
N'-[3-[[2-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]propyl]-N-methylbutanediamide (PubChem CID 167048864) has the molecular formula C23H29N5O8 and a molecular weight of 503.51 g/mol. Its IUPAC name is N'-[3-[[2-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]propyl]-N-methylbutanediamide.
| Compound Name | N'-[3-[[2-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]propyl]-N-methylbutanediamide |
|---|---|
| PubChem CID | 167048864 |
| Molecular Formula | C23H29N5O8 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | N'-[3-[[2-[2-(1-amino-1,5-dioxopentan-2-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]propyl]-N-methylbutanediamide |
| SMILES | CNC(=O)CCC(=O)NCCCNC(=O)COc1cccc2c1C(=O)N(C(CCC=O)C(N)=O)C2=O |
| InChI | InChI=1S/C23H29N5O8/c1-25-17(30)8-9-18(31)26-10-4-11-27-19(32)13-36-16-7-2-5-14-20(16)23(35)28(22(14)34)15(21(24)33)6-3-12-29/h2,5,7,12,15H,3-4,6,8-11,13H2,1H3,(H2,24,33)(H,25,30)(H,26,31)(H,27,32) |
| InChIKey | YAZQYWJVYVNUPL-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|