C21H28N2O7 — CID 142612079
2-[1,3-dioxo-4-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethylamino]isoindol-2-yl]pentanal (PubChem CID 142612079) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-[1,3-dioxo-4-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethylamino]isoindol-2-yl]pentanal.
| Compound Name | 2-[1,3-dioxo-4-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethylamino]isoindol-2-yl]pentanal |
|---|---|
| PubChem CID | 142612079 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[1,3-dioxo-4-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethylamino]isoindol-2-yl]pentanal |
| SMILES | CCCC(C=O)N1C(=O)c2cccc(NCCOCCOCCOCC=O)c2C1=O |
| InChI | InChI=1S/C21H28N2O7/c1-2-4-16(15-25)23-20(26)17-5-3-6-18(19(17)21(23)27)22-7-9-28-11-13-30-14-12-29-10-8-24/h3,5-6,8,15-16,22H,2,4,7,9-14H2,1H3 |
| InChIKey | ROAMLRCTKUZFAQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|