C34H46N4O9 — CID 170639881
N-[4-[[2-(5-formamidohex-5-en-2-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-[2-[2-[2-[4-(hydroxymethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetamide (PubChem CID 170639881) has the molecular formula C34H46N4O9 and a molecular weight of 654.76 g/mol. Its IUPAC name is N-[4-[[2-(5-formamidohex-5-en-2-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-[2-[2-[2-[4-(hydroxymethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetamide.
| Compound Name | N-[4-[[2-(5-formamidohex-5-en-2-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-[2-[2-[2-[4-(hydroxymethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 170639881 |
| Molecular Formula | C34H46N4O9 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.33 |
| IUPAC Name | N-[4-[[2-(5-formamidohex-5-en-2-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-[2-[2-[2-[4-(hydroxymethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetamide |
| SMILES | C=C(CCC(C)N1C(=O)c2cccc(NCCCCNC(=O)COCCOCCOCCOc3ccc(CO)cc3)c2C1=O)NC=O |
| InChI | InChI=1S/C34H46N4O9/c1-25(37-24-40)8-9-26(2)38-33(42)29-6-5-7-30(32(29)34(38)43)35-14-3-4-15-36-31(41)23-46-19-18-44-16-17-45-20-21-47-28-12-10-27(22-39)11-13-28/h5-7,10-13,24,26,35,39H,1,3-4,8-9,14-23H2,2H3,(H,36,41)(H,37,40) |
| InChIKey | DFBVGGUJGYIDDT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 164.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|