C29H45N3O7 — CID 145382150
4-[4-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene;ethane (PubChem CID 145382150) has the molecular formula C29H45N3O7 and a molecular weight of 547.69 g/mol. Its IUPAC name is 4-[4-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene;ethane.
| Compound Name | 4-[4-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene;ethane |
|---|---|
| PubChem CID | 145382150 |
| Molecular Formula | C29H45N3O7 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | 4-[4-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propyl]-1,3-dioxoisoindol-2-yl]-N-formylpentanamide;buta-1,3-diene;ethane |
| SMILES | C=CC=C.CC.CC(CCC(=O)NC=O)N1C(=O)c2cccc(CCCOCCOCCOCCN)c2C1=O |
| InChI | InChI=1S/C23H33N3O7.C4H6.C2H6/c1-17(7-8-20(28)25-16-27)26-22(29)19-6-2-4-18(21(19)23(26)30)5-3-10-31-12-14-33-15-13-32-11-9-24;1-3-4-2;1-2/h2,4,6,16-17H,3,5,7-15,24H2,1H3,(H,25,27,28);3-4H,1-2H2;1-2H3 |
| InChIKey | LGIZCLDUAYENGE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|