C22H26N2O4 — CID 156802752
ethane;4-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-formylpentanamide (PubChem CID 156802752) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethane;4-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-formylpentanamide.
| Compound Name | ethane;4-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-formylpentanamide |
|---|---|
| PubChem CID | 156802752 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethane;4-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-formylpentanamide |
| SMILES | CC.CCc1cc2c3c(cccc3c1)C(=O)N(C(C)CCC(=O)NC=O)C2=O |
| InChI | InChI=1S/C20H20N2O4.C2H6/c1-3-13-9-14-5-4-6-15-18(14)16(10-13)20(26)22(19(15)25)12(2)7-8-17(24)21-11-23;1-2/h4-6,9-12H,3,7-8H2,1-2H3,(H,21,23,24);1-2H3 |
| InChIKey | OHOSTPNYXIFGHN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|