C19H17NO4 — CID 165088334
2-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)pentanedial (PubChem CID 165088334) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)pentanedial.
| Compound Name | 2-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)pentanedial |
|---|---|
| PubChem CID | 165088334 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-(5-ethyl-1,3-dioxobenzo[de]isoquinolin-2-yl)pentanedial |
| SMILES | CCc1cc2c3c(cccc3c1)C(=O)N(C(C=O)CCC=O)C2=O |
| InChI | InChI=1S/C19H17NO4/c1-2-12-9-13-5-3-7-15-17(13)16(10-12)19(24)20(18(15)23)14(11-22)6-4-8-21/h3,5,7-11,14H,2,4,6H2,1H3 |
| InChIKey | OQNLLLYQONHDTN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|