C14H15NO3 — CID 18607607
(2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanal (PubChem CID 18607607) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanal.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanal |
|---|---|
| PubChem CID | 18607607 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanal |
| SMILES | CC(C)C[C@@H](C=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO3/c1-9(2)7-10(8-16)15-13(17)11-5-3-4-6-12(11)14(15)18/h3-6,8-10H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | IUHQSHUUXCBZPL-JTQLQIEISA-N |
| XLogP | 1.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|