C15H18N4O2S — CID 156583223
[(E)-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentylidene]amino]thiourea (PubChem CID 156583223) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is [(E)-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentylidene]amino]thiourea.
| Compound Name | [(E)-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentylidene]amino]thiourea |
|---|---|
| PubChem CID | 156583223 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [(E)-[2-(1,3-dioxoisoindol-2-yl)-4-methylpentylidene]amino]thiourea |
| SMILES | CC(C)CC(/C=N/NC(N)=S)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H18N4O2S/c1-9(2)7-10(8-17-18-15(16)22)19-13(20)11-5-3-4-6-12(11)14(19)21/h3-6,8-10H,7H2,1-2H3,(H3,16,18,22)/b17-8+ |
| InChIKey | PZCFJCNTGHSEJF-CAOOACKPSA-N |
| XLogP | 1.52 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|