C11H13N5O2S — CID 156721486
N'-(aminosulfanylamino)-2-(1,3-dioxoisoindol-2-yl)propanimidamide (PubChem CID 156721486) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is N'-(aminosulfanylamino)-2-(1,3-dioxoisoindol-2-yl)propanimidamide.
| Compound Name | N'-(aminosulfanylamino)-2-(1,3-dioxoisoindol-2-yl)propanimidamide |
|---|---|
| PubChem CID | 156721486 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N'-(aminosulfanylamino)-2-(1,3-dioxoisoindol-2-yl)propanimidamide |
| SMILES | CC(/C(N)=N/NSN)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H13N5O2S/c1-6(9(12)14-15-19-13)16-10(17)7-4-2-3-5-8(7)11(16)18/h2-6,15H,13H2,1H3,(H2,12,14) |
| InChIKey | WCACCOXXRTWEDC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|