C17H15N3O4 — CID 142676185
2-(1,3-dioxobenzo[e]isoindol-2-yl)pentanediamide (PubChem CID 142676185) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-(1,3-dioxobenzo[e]isoindol-2-yl)pentanediamide.
| Compound Name | 2-(1,3-dioxobenzo[e]isoindol-2-yl)pentanediamide |
|---|---|
| PubChem CID | 142676185 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(1,3-dioxobenzo[e]isoindol-2-yl)pentanediamide |
| SMILES | NC(=O)CCC(C(N)=O)N1C(=O)c2ccc3ccccc3c2C1=O |
| InChI | InChI=1S/C17H15N3O4/c18-13(21)8-7-12(15(19)22)20-16(23)11-6-5-9-3-1-2-4-10(9)14(11)17(20)24/h1-6,12H,7-8H2,(H2,18,21)(H2,19,22) |
| InChIKey | KFFOKSBRPKWMFE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|