C13H8Br4N2O5 — CID 1179782
(2S)-5-amino-5-oxo-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 1179782) has the molecular formula C13H8Br4N2O5 and a molecular weight of 591.83 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 1179782 |
| Molecular Formula | C13H8Br4N2O5 |
| Molecular Weight | 591.83 g/mol |
| Exact Mass | 587.72 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N1C(=O)c2c(Br)c(Br)c(Br)c(Br)c2C1=O |
| InChI | InChI=1S/C13H8Br4N2O5/c14-7-5-6(8(15)10(17)9(7)16)12(22)19(11(5)21)3(13(23)24)1-2-4(18)20/h3H,1-2H2,(H2,18,20)(H,23,24)/t3-/m0/s1 |
| InChIKey | PIKVWMZLWUYYED-VKHMYHEASA-N |
| XLogP | 3.05 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|