C13H8Br4NO4S- — CID 53451398
4-methylsulfanyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 53451398) has the molecular formula C13H8Br4NO4S- and a molecular weight of 593.89 g/mol. Its IUPAC name is 4-methylsulfanyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | 4-methylsulfanyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 53451398 |
| Molecular Formula | C13H8Br4NO4S- |
| Molecular Weight | 593.89 g/mol |
| Exact Mass | 589.69 |
| IUPAC Name | 4-methylsulfanyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CSCCC(C(=O)[O-])N1C(=O)c2c(Br)c(Br)c(Br)c(Br)c2C1=O |
| InChI | InChI=1S/C13H9Br4NO4S/c1-23-3-2-4(13(21)22)18-11(19)5-6(12(18)20)8(15)10(17)9(16)7(5)14/h4H,2-3H2,1H3,(H,21,22)/p-1 |
| InChIKey | MODAKIKOZDYIGO-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|