C15H14N2O5S2 — CID 18841601
5-amino-2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoic acid (PubChem CID 18841601) has the molecular formula C15H14N2O5S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 5-amino-2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18841601 |
| Molecular Formula | C15H14N2O5S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 5-amino-2-[(5Z)-5-[(4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(C(=O)O)N1C(=O)/C(=C/c2ccc(O)cc2)SC1=S |
| InChI | InChI=1S/C15H14N2O5S2/c16-12(19)6-5-10(14(21)22)17-13(20)11(24-15(17)23)7-8-1-3-9(18)4-2-8/h1-4,7,10,18H,5-6H2,(H2,16,19)(H,21,22)/b11-7- |
| InChIKey | FEUXXOKAIHBYQU-XFFZJAGNSA-N |
| XLogP | 1.31 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|