C26H20Cl2N2O4S4 — CID 4014400
2,6-bis[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 4014400) has the molecular formula C26H20Cl2N2O4S4 and a molecular weight of 623.63 g/mol. Its IUPAC name is 2,6-bis[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 2,6-bis[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 4014400 |
| Molecular Formula | C26H20Cl2N2O4S4 |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 621.97 |
| IUPAC Name | 2,6-bis[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)C(CCCCN1C(=O)C(=Cc2ccc(Cl)cc2)SC1=S)N1C(=O)C(=Cc2ccc(Cl)cc2)SC1=S |
| InChI | InChI=1S/C26H20Cl2N2O4S4/c27-17-8-4-15(5-9-17)13-20-22(31)29(25(35)37-20)12-2-1-3-19(24(33)34)30-23(32)21(38-26(30)36)14-16-6-10-18(28)11-7-16/h4-11,13-14,19H,1-3,12H2,(H,33,34) |
| InChIKey | MLNQFRQBPJFQAI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|