C22H20ClNO3S2 — CID 177371121
(2S)-2-[(5Z)-5-[[4-(3-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 177371121) has the molecular formula C22H20ClNO3S2 and a molecular weight of 445.99 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[[4-(3-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | (2S)-2-[(5Z)-5-[[4-(3-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 177371121 |
| Molecular Formula | C22H20ClNO3S2 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | (2S)-2-[(5Z)-5-[[4-(3-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCCC[C@@H](C(=O)O)N1C(=O)/C(=C/c2ccc(-c3cccc(Cl)c3)cc2)SC1=S |
| InChI | InChI=1S/C22H20ClNO3S2/c1-2-3-7-18(21(26)27)24-20(25)19(29-22(24)28)12-14-8-10-15(11-9-14)16-5-4-6-17(23)13-16/h4-6,8-13,18H,2-3,7H2,1H3,(H,26,27)/b19-12-/t18-/m0/s1 |
| InChIKey | JWKVSIDOJRWUNT-IZILLXMLSA-N |
| XLogP | 5.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|