C25H24N2O4 — CID 143127663
(4E,5Z,7Z)-3-(1,3-dioxobenzo[e]isoindol-2-yl)-8-ethoxy-4-ethylidene-7-methoxyocta-5,7-dienenitrile (PubChem CID 143127663) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is (4E,5Z,7Z)-3-(1,3-dioxobenzo[e]isoindol-2-yl)-8-ethoxy-4-ethylidene-7-methoxyocta-5,7-dienenitrile.
| Compound Name | (4E,5Z,7Z)-3-(1,3-dioxobenzo[e]isoindol-2-yl)-8-ethoxy-4-ethylidene-7-methoxyocta-5,7-dienenitrile |
|---|---|
| PubChem CID | 143127663 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (4E,5Z,7Z)-3-(1,3-dioxobenzo[e]isoindol-2-yl)-8-ethoxy-4-ethylidene-7-methoxyocta-5,7-dienenitrile |
| SMILES | C/C=C(\C=C/C(=C/OCC)OC)C(CC#N)N1C(=O)c2ccc3ccccc3c2C1=O |
| InChI | InChI=1S/C25H24N2O4/c1-4-17(10-12-19(30-3)16-31-5-2)22(14-15-26)27-24(28)21-13-11-18-8-6-7-9-20(18)23(21)25(27)29/h4,6-13,16,22H,5,14H2,1-3H3/b12-10-,17-4+,19-16- |
| InChIKey | KJEIUQRPSQMVEL-UTUDWSFHSA-N |
| XLogP | 4.74 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|