C23H23N3O5 — CID 143246329
3-[1,3-dioxo-4-(1-oxopropan-2-ylamino)isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanenitrile (PubChem CID 143246329) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 3-[1,3-dioxo-4-(1-oxopropan-2-ylamino)isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanenitrile.
| Compound Name | 3-[1,3-dioxo-4-(1-oxopropan-2-ylamino)isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 143246329 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-[1,3-dioxo-4-(1-oxopropan-2-ylamino)isoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propanenitrile |
| SMILES | CCOc1cc(C(CC#N)N2C(=O)c3cccc(NC(C)C=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C23H23N3O5/c1-4-31-20-12-15(8-9-19(20)30-3)18(10-11-24)26-22(28)16-6-5-7-17(21(16)23(26)29)25-14(2)13-27/h5-9,12-14,18,25H,4,10H2,1-3H3 |
| InChIKey | HTCWIMBMSSCJLH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|