C21H18N4O4 — CID 154862194
2-(1,3-dioxoisoindol-2-yl)-N-(1H-indol-5-yl)pentanediamide (PubChem CID 154862194) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(1H-indol-5-yl)pentanediamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1H-indol-5-yl)pentanediamide |
|---|---|
| PubChem CID | 154862194 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1H-indol-5-yl)pentanediamide |
| SMILES | NC(=O)CCC(C(=O)Nc1ccc2[nH]ccc2c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H18N4O4/c22-18(26)8-7-17(25-20(28)14-3-1-2-4-15(14)21(25)29)19(27)24-13-5-6-16-12(11-13)9-10-23-16/h1-6,9-11,17,23H,7-8H2,(H2,22,26)(H,24,27) |
| InChIKey | JJEQTOHBOZEYGA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|