C14H15N3O4 — CID 63748597
(2S)-5-amino-2-(1H-indole-5-carbonylamino)-5-oxopentanoic acid (PubChem CID 63748597) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2S)-5-amino-2-(1H-indole-5-carbonylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-(1H-indole-5-carbonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 63748597 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (2S)-5-amino-2-(1H-indole-5-carbonylamino)-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)c1ccc2[nH]ccc2c1)C(=O)O |
| InChI | InChI=1S/C14H15N3O4/c15-12(18)4-3-11(14(20)21)17-13(19)9-1-2-10-8(7-9)5-6-16-10/h1-2,5-7,11,16H,3-4H2,(H2,15,18)(H,17,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | UYNAQQOYBDZDEJ-NSHDSACASA-N |
| XLogP | 0.62 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |