C25H22N2O8S — CID 67975913
2-[1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylsulfonylethyl]-4-nitroisoindole-1,3-dione (PubChem CID 67975913) has the molecular formula C25H22N2O8S and a molecular weight of 510.52 g/mol. Its IUPAC name is 2-[1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylsulfonylethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylsulfonylethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67975913 |
| Molecular Formula | C25H22N2O8S |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-[1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylsulfonylethyl]-4-nitroisoindole-1,3-dione |
| SMILES | COc1ccc(C(CS(C)(=O)=O)N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H22N2O8S/c1-34-21-12-11-17(13-22(21)35-14-16-7-4-3-5-8-16)20(15-36(2,32)33)26-24(28)18-9-6-10-19(27(30)31)23(18)25(26)29/h3-13,20H,14-15H2,1-2H3 |
| InChIKey | NJSKUTJKEWYDQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|