C19H20N2O5S — CID 159671413
4-amino-2-[1-(4-methoxy-3-methylphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione (PubChem CID 159671413) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-amino-2-[1-(4-methoxy-3-methylphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[1-(4-methoxy-3-methylphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 159671413 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-amino-2-[1-(4-methoxy-3-methylphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(CS(C)(=O)=O)N2C(=O)c3cccc(N)c3C2=O)cc1C |
| InChI | InChI=1S/C19H20N2O5S/c1-11-9-12(7-8-16(11)26-2)15(10-27(3,24)25)21-18(22)13-5-4-6-14(20)17(13)19(21)23/h4-9,15H,10,20H2,1-3H3 |
| InChIKey | MUAUSIBCSLYVGO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|