C18H18N2O8S2 — CID 141237097
5-[1-(4-ethoxy-3-methoxyphenyl)-2-methylsulfonylethyl]-3-nitrothieno[3,4-c]pyrrole-4,6-dione (PubChem CID 141237097) has the molecular formula C18H18N2O8S2 and a molecular weight of 454.48 g/mol. Its IUPAC name is 5-[1-(4-ethoxy-3-methoxyphenyl)-2-methylsulfonylethyl]-3-nitrothieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-[1-(4-ethoxy-3-methoxyphenyl)-2-methylsulfonylethyl]-3-nitrothieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 141237097 |
| Molecular Formula | C18H18N2O8S2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 5-[1-(4-ethoxy-3-methoxyphenyl)-2-methylsulfonylethyl]-3-nitrothieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCOc1ccc(C(CS(C)(=O)=O)N2C(=O)c3csc([N+](=O)[O-])c3C2=O)cc1OC |
| InChI | InChI=1S/C18H18N2O8S2/c1-4-28-13-6-5-10(7-14(13)27-2)12(9-30(3,25)26)19-16(21)11-8-29-18(20(23)24)15(11)17(19)22/h5-8,12H,4,9H2,1-3H3 |
| InChIKey | ULEYDXNMDBQMHP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|